C26H24BrN3O5 — CID 5044347
1-(4-benzylpiperidin-1-yl)-2-(5-bromo-2-oxo-1-pyridinyl)-3-(4-nitrophenyl)propane-1,3-dione (PubChem CID 5044347) has the molecular formula C26H24BrN3O5 and a molecular weight of 538.40 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-2-(5-bromo-2-oxo-1-pyridinyl)-3-(4-nitrophenyl)propane-1,3-dione.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-2-(5-bromo-2-oxo-1-pyridinyl)-3-(4-nitrophenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 5044347 |
| Molecular Formula | C26H24BrN3O5 |
| Molecular Weight | 538.40 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-2-(5-bromo-2-oxo-1-pyridinyl)-3-(4-nitrophenyl)propane-1,3-dione |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)C(C(=O)N1CCC(Cc2ccccc2)CC1)n1cc(Br)ccc1=O |
| InChI | InChI=1S/C26H24BrN3O5/c27-21-8-11-23(31)29(17-21)24(25(32)20-6-9-22(10-7-20)30(34)35)26(33)28-14-12-19(13-15-28)16-18-4-2-1-3-5-18/h1-11,17,19,24H,12-16H2 |
| InChIKey | OYKASTDDPYOBMO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 102.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|