C25H23BrN4O5 — CID 3652417
1-(4-benzylpiperazin-1-yl)-2-(5-bromo-2-oxo-1-pyridinyl)-3-(4-nitrophenyl)propane-1,3-dione (PubChem CID 3652417) has the molecular formula C25H23BrN4O5 and a molecular weight of 539.39 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-2-(5-bromo-2-oxo-1-pyridinyl)-3-(4-nitrophenyl)propane-1,3-dione.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-2-(5-bromo-2-oxo-1-pyridinyl)-3-(4-nitrophenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 3652417 |
| Molecular Formula | C25H23BrN4O5 |
| Molecular Weight | 539.39 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-2-(5-bromo-2-oxo-1-pyridinyl)-3-(4-nitrophenyl)propane-1,3-dione |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)C(C(=O)N1CCN(Cc2ccccc2)CC1)n1cc(Br)ccc1=O |
| InChI | InChI=1S/C25H23BrN4O5/c26-20-8-11-22(31)29(17-20)23(24(32)19-6-9-21(10-7-19)30(34)35)25(33)28-14-12-27(13-15-28)16-18-4-2-1-3-5-18/h1-11,17,23H,12-16H2 |
| InChIKey | DZOMUNYNGXCDLN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 105.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|