C27H27FN2O3 — CID 30884834
(2R)-1-(4-benzylpiperidin-1-yl)-3-(4-fluorophenyl)-2-(5-methyl-2-oxo-1-pyridinyl)propane-1,3-dione (PubChem CID 30884834) has the molecular formula C27H27FN2O3 and a molecular weight of 446.52 g/mol. Its IUPAC name is (2R)-1-(4-benzylpiperidin-1-yl)-3-(4-fluorophenyl)-2-(5-methyl-2-oxo-1-pyridinyl)propane-1,3-dione.
| Compound Name | (2R)-1-(4-benzylpiperidin-1-yl)-3-(4-fluorophenyl)-2-(5-methyl-2-oxo-1-pyridinyl)propane-1,3-dione |
|---|---|
| PubChem CID | 30884834 |
| Molecular Formula | C27H27FN2O3 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (2R)-1-(4-benzylpiperidin-1-yl)-3-(4-fluorophenyl)-2-(5-methyl-2-oxo-1-pyridinyl)propane-1,3-dione |
| SMILES | Cc1ccc(=O)n([C@H](C(=O)c2ccc(F)cc2)C(=O)N2CCC(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C27H27FN2O3/c1-19-7-12-24(31)30(18-19)25(26(32)22-8-10-23(28)11-9-22)27(33)29-15-13-21(14-16-29)17-20-5-3-2-4-6-20/h2-12,18,21,25H,13-17H2,1H3/t25-/m1/s1 |
| InChIKey | JRHIJZHJVYIVLP-RUZDIDTESA-N |
| XLogP | 4.20 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|