C22H26FNO2 — CID 28567351
(2R)-1-(4-benzylpiperidin-1-yl)-2-(4-fluorophenoxy)butan-1-one (PubChem CID 28567351) has the molecular formula C22H26FNO2 and a molecular weight of 355.45 g/mol. Its IUPAC name is (2R)-1-(4-benzylpiperidin-1-yl)-2-(4-fluorophenoxy)butan-1-one.
| Compound Name | (2R)-1-(4-benzylpiperidin-1-yl)-2-(4-fluorophenoxy)butan-1-one |
|---|---|
| PubChem CID | 28567351 |
| Molecular Formula | C22H26FNO2 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (2R)-1-(4-benzylpiperidin-1-yl)-2-(4-fluorophenoxy)butan-1-one |
| SMILES | CC[C@@H](Oc1ccc(F)cc1)C(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H26FNO2/c1-2-21(26-20-10-8-19(23)9-11-20)22(25)24-14-12-18(13-15-24)16-17-6-4-3-5-7-17/h3-11,18,21H,2,12-16H2,1H3/t21-/m1/s1 |
| InChIKey | JQFXAGUBBKUOLA-OAQYLSRUSA-N |
| XLogP | 4.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |