C28H28FN3O4 — CID 3979678
1-[3-(4-fluorophenyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanoyl]-N-(1-phenylethyl)piperidine-4-carboxamide (PubChem CID 3979678) has the molecular formula C28H28FN3O4 and a molecular weight of 489.55 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanoyl]-N-(1-phenylethyl)piperidine-4-carboxamide.
| Compound Name | 1-[3-(4-fluorophenyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanoyl]-N-(1-phenylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3979678 |
| Molecular Formula | C28H28FN3O4 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 1-[3-(4-fluorophenyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanoyl]-N-(1-phenylethyl)piperidine-4-carboxamide |
| SMILES | CC(NC(=O)C1CCN(C(=O)C(C(=O)c2ccc(F)cc2)n2ccccc2=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H28FN3O4/c1-19(20-7-3-2-4-8-20)30-27(35)22-14-17-31(18-15-22)28(36)25(32-16-6-5-9-24(32)33)26(34)21-10-12-23(29)13-11-21/h2-13,16,19,22,25H,14-15,17-18H2,1H3,(H,30,35) |
| InChIKey | FFXWXIYWLHENLA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|