C14H15FN2O4 — CID 87424149
[1-(4-fluorophenyl)-1,3-dioxo-3-pyrrolidin-1-ylpropan-2-yl]carbamic acid (PubChem CID 87424149) has the molecular formula C14H15FN2O4 and a molecular weight of 294.28 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-1,3-dioxo-3-pyrrolidin-1-ylpropan-2-yl]carbamic acid.
| Compound Name | [1-(4-fluorophenyl)-1,3-dioxo-3-pyrrolidin-1-ylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87424149 |
| Molecular Formula | C14H15FN2O4 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | [1-(4-fluorophenyl)-1,3-dioxo-3-pyrrolidin-1-ylpropan-2-yl]carbamic acid |
| SMILES | O=C(O)NC(C(=O)c1ccc(F)cc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C14H15FN2O4/c15-10-5-3-9(4-6-10)12(18)11(16-14(20)21)13(19)17-7-1-2-8-17/h3-6,11,16H,1-2,7-8H2,(H,20,21) |
| InChIKey | WUBICCVQWBKROU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|