C16H15FN2O4 — CID 7324233
(2S)-3-(4-fluorophenyl)-N-(2-hydroxyethyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanamide (PubChem CID 7324233) has the molecular formula C16H15FN2O4 and a molecular weight of 318.30 g/mol. Its IUPAC name is (2S)-3-(4-fluorophenyl)-N-(2-hydroxyethyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanamide.
| Compound Name | (2S)-3-(4-fluorophenyl)-N-(2-hydroxyethyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanamide |
|---|---|
| PubChem CID | 7324233 |
| Molecular Formula | C16H15FN2O4 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (2S)-3-(4-fluorophenyl)-N-(2-hydroxyethyl)-3-oxo-2-(2-oxo-1-pyridinyl)propanamide |
| SMILES | O=C(NCCO)[C@H](C(=O)c1ccc(F)cc1)n1ccccc1=O |
| InChI | InChI=1S/C16H15FN2O4/c17-12-6-4-11(5-7-12)15(22)14(16(23)18-8-10-20)19-9-2-1-3-13(19)21/h1-7,9,14,20H,8,10H2,(H,18,23)/t14-/m0/s1 |
| InChIKey | GTQLXGXKAXUIAG-AWEZNQCLSA-N |
| XLogP | 0.52 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|