C20H23FN3O3+ — CID 7323647
(2S)-3-(4-fluorophenyl)-3-oxo-2-(2-oxo-1-pyridinyl)-N-(2-pyrrolidin-1-ium-1-ylethyl)propanamide (PubChem CID 7323647) has the molecular formula C20H23FN3O3+ and a molecular weight of 372.42 g/mol. Its IUPAC name is (2S)-3-(4-fluorophenyl)-3-oxo-2-(2-oxo-1-pyridinyl)-N-(2-pyrrolidin-1-ium-1-ylethyl)propanamide.
| Compound Name | (2S)-3-(4-fluorophenyl)-3-oxo-2-(2-oxo-1-pyridinyl)-N-(2-pyrrolidin-1-ium-1-ylethyl)propanamide |
|---|---|
| PubChem CID | 7323647 |
| Molecular Formula | C20H23FN3O3+ |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (2S)-3-(4-fluorophenyl)-3-oxo-2-(2-oxo-1-pyridinyl)-N-(2-pyrrolidin-1-ium-1-ylethyl)propanamide |
| SMILES | O=C(NCC[NH+]1CCCC1)[C@H](C(=O)c1ccc(F)cc1)n1ccccc1=O |
| InChI | InChI=1S/C20H22FN3O3/c21-16-8-6-15(7-9-16)19(26)18(24-13-2-1-5-17(24)25)20(27)22-10-14-23-11-3-4-12-23/h1-2,5-9,13,18H,3-4,10-12,14H2,(H,22,27)/p+1/t18-/m0/s1 |
| InChIKey | IGWWDXGAECSOFJ-SFHVURJKSA-O |
| XLogP | 0.21 |
| TPSA | 72.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|