C23H25ClFN3O3 — CID 69277958
2-[(4-fluorophenyl)methyl]-1,3-dioxo-N-(2-piperidin-1-ium-1-ylethyl)isoindole-5-carboxamide chloride (PubChem CID 69277958) has the molecular formula C23H25ClFN3O3 and a molecular weight of 445.92 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-1,3-dioxo-N-(2-piperidin-1-ium-1-ylethyl)isoindole-5-carboxamide chloride.
| Compound Name | 2-[(4-fluorophenyl)methyl]-1,3-dioxo-N-(2-piperidin-1-ium-1-ylethyl)isoindole-5-carboxamide chloride |
|---|---|
| PubChem CID | 69277958 |
| Molecular Formula | C23H25ClFN3O3 |
| Molecular Weight | 445.92 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-1,3-dioxo-N-(2-piperidin-1-ium-1-ylethyl)isoindole-5-carboxamide chloride |
| SMILES | O=C(NCC[NH+]1CCCCC1)c1ccc2c(c1)C(=O)N(Cc1ccc(F)cc1)C2=O.[Cl-] |
| InChI | InChI=1S/C23H24FN3O3.ClH/c24-18-7-4-16(5-8-18)15-27-22(29)19-9-6-17(14-20(19)23(27)30)21(28)25-10-13-26-11-2-1-3-12-26;/h4-9,14H,1-3,10-13,15H2,(H,25,28);1H |
| InChIKey | GIIOUHZRAWTKBO-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.92 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|