C22H23Cl2N3O4 — CID 69279104
2-[(2-chlorophenyl)methyl]-N-(2-morpholin-4-ium-4-ylethyl)-1,3-dioxoisoindole-5-carboxamide chloride (PubChem CID 69279104) has the molecular formula C22H23Cl2N3O4 and a molecular weight of 464.35 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-N-(2-morpholin-4-ium-4-ylethyl)-1,3-dioxoisoindole-5-carboxamide chloride.
| Compound Name | 2-[(2-chlorophenyl)methyl]-N-(2-morpholin-4-ium-4-ylethyl)-1,3-dioxoisoindole-5-carboxamide chloride |
|---|---|
| PubChem CID | 69279104 |
| Molecular Formula | C22H23Cl2N3O4 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-N-(2-morpholin-4-ium-4-ylethyl)-1,3-dioxoisoindole-5-carboxamide chloride |
| SMILES | O=C(NCC[NH+]1CCOCC1)c1ccc2c(c1)C(=O)N(Cc1ccccc1Cl)C2=O.[Cl-] |
| InChI | InChI=1S/C22H22ClN3O4.ClH/c23-19-4-2-1-3-16(19)14-26-21(28)17-6-5-15(13-18(17)22(26)29)20(27)24-7-8-25-9-11-30-12-10-25;/h1-6,13H,7-12,14H2,(H,24,27);1H |
| InChIKey | PNTCLDGRJAGINV-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|