C21H23N2O5S+ — CID 7689836
N-(3-morpholin-4-ium-4-ylpropyl)-9,10,10-trioxothioxanthene-3-carboxamide (PubChem CID 7689836) has the molecular formula C21H23N2O5S+ and a molecular weight of 415.49 g/mol. Its IUPAC name is N-(3-morpholin-4-ium-4-ylpropyl)-9,10,10-trioxothioxanthene-3-carboxamide.
| Compound Name | N-(3-morpholin-4-ium-4-ylpropyl)-9,10,10-trioxothioxanthene-3-carboxamide |
|---|---|
| PubChem CID | 7689836 |
| Molecular Formula | C21H23N2O5S+ |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | N-(3-morpholin-4-ium-4-ylpropyl)-9,10,10-trioxothioxanthene-3-carboxamide |
| SMILES | O=C(NCCC[NH+]1CCOCC1)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H22N2O5S/c24-20-16-4-1-2-5-18(16)29(26,27)19-14-15(6-7-17(19)20)21(25)22-8-3-9-23-10-12-28-13-11-23/h1-2,4-7,14H,3,8-13H2,(H,22,25)/p+1 |
| InChIKey | PIMOURBIQOWXNT-UHFFFAOYSA-O |
| XLogP | 0.10 |
| TPSA | 93.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|