C24H20ClNO5S — CID 16571878
N-[4-(4-chlorophenoxy)butyl]-9,10,10-trioxothioxanthene-3-carboxamide (PubChem CID 16571878) has the molecular formula C24H20ClNO5S and a molecular weight of 469.95 g/mol. Its IUPAC name is N-[4-(4-chlorophenoxy)butyl]-9,10,10-trioxothioxanthene-3-carboxamide.
| Compound Name | N-[4-(4-chlorophenoxy)butyl]-9,10,10-trioxothioxanthene-3-carboxamide |
|---|---|
| PubChem CID | 16571878 |
| Molecular Formula | C24H20ClNO5S |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | N-[4-(4-chlorophenoxy)butyl]-9,10,10-trioxothioxanthene-3-carboxamide |
| SMILES | O=C(NCCCCOc1ccc(Cl)cc1)c1ccc2c(c1)S(=O)(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H20ClNO5S/c25-17-8-10-18(11-9-17)31-14-4-3-13-26-24(28)16-7-12-20-22(15-16)32(29,30)21-6-2-1-5-19(21)23(20)27/h1-2,5-12,15H,3-4,13-14H2,(H,26,28) |
| InChIKey | DOIATJLIRBAVGQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|