C24H22ClN3O4S — CID 31676926
N-[4-(4-chlorophenoxy)butyl]-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide (PubChem CID 31676926) has the molecular formula C24H22ClN3O4S and a molecular weight of 483.98 g/mol. Its IUPAC name is N-[4-(4-chlorophenoxy)butyl]-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide.
| Compound Name | N-[4-(4-chlorophenoxy)butyl]-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide |
|---|---|
| PubChem CID | 31676926 |
| Molecular Formula | C24H22ClN3O4S |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | N-[4-(4-chlorophenoxy)butyl]-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide |
| SMILES | O=C(NCCCCOc1ccc(Cl)cc1)c1ccc(NC2=NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H22ClN3O4S/c25-18-9-13-20(14-10-18)32-16-4-3-15-26-24(29)17-7-11-19(12-8-17)27-23-21-5-1-2-6-22(21)33(30,31)28-23/h1-2,5-14H,3-4,15-16H2,(H,26,29)(H,27,28) |
| InChIKey | GEYSJFABLNLGGW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|