C19H20N2O4S — CID 37134520
3-methylbutyl 4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoate (PubChem CID 37134520) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is 3-methylbutyl 4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoate.
| Compound Name | 3-methylbutyl 4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoate |
|---|---|
| PubChem CID | 37134520 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 3-methylbutyl 4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoate |
| SMILES | CC(C)CCOC(=O)c1ccc(NC2=NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C19H20N2O4S/c1-13(2)11-12-25-19(22)14-7-9-15(10-8-14)20-18-16-5-3-4-6-17(16)26(23,24)21-18/h3-10,13H,11-12H2,1-2H3,(H,20,21) |
| InChIKey | XJFYXZSLADEKEZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |