C22H18N4O4S — CID 55860499
N-(2-anilino-2-oxoethyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide (PubChem CID 55860499) has the molecular formula C22H18N4O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is N-(2-anilino-2-oxoethyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide.
| Compound Name | N-(2-anilino-2-oxoethyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide |
|---|---|
| PubChem CID | 55860499 |
| Molecular Formula | C22H18N4O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | N-(2-anilino-2-oxoethyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(NC2=NS(=O)(=O)c3ccccc32)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C22H18N4O4S/c27-20(24-16-6-2-1-3-7-16)14-23-22(28)15-10-12-17(13-11-15)25-21-18-8-4-5-9-19(18)31(29,30)26-21/h1-13H,14H2,(H,23,28)(H,24,27)(H,25,26) |
| InChIKey | ATEFDGZUXCHDAJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |