C20H22N4O3S — CID 119477085
N-(4-aminocyclohexyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide (PubChem CID 119477085) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide.
| Compound Name | N-(4-aminocyclohexyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide |
|---|---|
| PubChem CID | 119477085 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-(4-aminocyclohexyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide |
| SMILES | NC1CCC(NC(=O)c2ccc(NC3=NS(=O)(=O)c4ccccc43)cc2)CC1 |
| InChI | InChI=1S/C20H22N4O3S/c21-14-7-11-16(12-8-14)23-20(25)13-5-9-15(10-6-13)22-19-17-3-1-2-4-18(17)28(26,27)24-19/h1-6,9-10,14,16H,7-8,11-12,21H2,(H,22,24)(H,23,25) |
| InChIKey | MMQLXDSYMQAHIH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |