C20H14BrN3O3S — CID 29371074
N-(4-bromophenyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide (PubChem CID 29371074) has the molecular formula C20H14BrN3O3S and a molecular weight of 456.32 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide.
| Compound Name | N-(4-bromophenyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide |
|---|---|
| PubChem CID | 29371074 |
| Molecular Formula | C20H14BrN3O3S |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 454.99 |
| IUPAC Name | N-(4-bromophenyl)-4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide |
| SMILES | O=C(Nc1ccc(Br)cc1)c1ccc(NC2=NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C20H14BrN3O3S/c21-14-7-11-16(12-8-14)23-20(25)13-5-9-15(10-6-13)22-19-17-3-1-2-4-18(17)28(26,27)24-19/h1-12H,(H,22,24)(H,23,25) |
| InChIKey | NFLNNUMDPHWZFB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |