C21H18N4O4S — CID 34950780
4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-(2-ethoxy-3-pyridinyl)benzamide (PubChem CID 34950780) has the molecular formula C21H18N4O4S and a molecular weight of 422.47 g/mol. Its IUPAC name is 4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-(2-ethoxy-3-pyridinyl)benzamide.
| Compound Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-(2-ethoxy-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 34950780 |
| Molecular Formula | C21H18N4O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-(2-ethoxy-3-pyridinyl)benzamide |
| SMILES | CCOc1ncccc1NC(=O)c1ccc(NC2=NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C21H18N4O4S/c1-2-29-21-17(7-5-13-22-21)24-20(26)14-9-11-15(12-10-14)23-19-16-6-3-4-8-18(16)30(27,28)25-19/h3-13H,2H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | XTRQUJDTUXUUKJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |