C20H16N2O3S — CID 1194613
1,1-dioxo-N-(4-phenylmethoxyphenyl)-1,2-benzothiazol-3-amine (PubChem CID 1194613) has the molecular formula C20H16N2O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is 1,1-dioxo-N-(4-phenylmethoxyphenyl)-1,2-benzothiazol-3-amine.
| Compound Name | 1,1-dioxo-N-(4-phenylmethoxyphenyl)-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 1194613 |
| Molecular Formula | C20H16N2O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 1,1-dioxo-N-(4-phenylmethoxyphenyl)-1,2-benzothiazol-3-amine |
| SMILES | O=S1(=O)N=C(Nc2ccc(OCc3ccccc3)cc2)c2ccccc21 |
| InChI | InChI=1S/C20H16N2O3S/c23-26(24)19-9-5-4-8-18(19)20(22-26)21-16-10-12-17(13-11-16)25-14-15-6-2-1-3-7-15/h1-13H,14H2,(H,21,22) |
| InChIKey | ZZQAGMZPDMKBQK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |