About [3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2-chloro-2-phenylacetate
[3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2-chloro-2-phenylacetate (PubChem CID 21213578) has the molecular formula C21H15ClN2O4S
and a molecular weight of 426.88 g/mol. Its IUPAC name is [3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2-chloro-2-phenylacetate.
Molecular Properties
| Compound Name | [3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2-chloro-2-phenylacetate |
| PubChem CID | 21213578 |
| Molecular Formula | C21H15ClN2O4S |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | [3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2-chloro-2-phenylacetate |
| SMILES | O=C(Oc1cccc(NC2=NS(=O)(=O)c3ccccc32)c1)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C21H15ClN2O4S/c22-19(14-7-2-1-3-8-14)21(25)28-16-10-6-9-15(13-16)23-20-17-11-4-5-12-18(17)29(26,27)24-20/h1-13,19H,(H,23,24) |
| InChIKey | KHNIAGKKSTYRCO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2-chloro-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2-chloro-2-phenylacetate?
The IUPAC name of [3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2-chloro-2-phenylacetate (CID 21213578) is [3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2-chloro-2-phenylacetate.
What is the SMILES notation for [3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2-chloro-2-phenylacetate?
The canonical SMILES for [3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2-chloro-2-phenylacetate is O=C(Oc1cccc(NC2=NS(=O)(=O)c3ccccc32)c1)C(Cl)c1ccccc1.
What is the InChIKey of [3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2-chloro-2-phenylacetate?
The InChIKey is KHNIAGKKSTYRCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15ClN2O4S/c22-19(14-7-2-1-3-8-14)21(25)28-16-10-6-9-15(13-16)23-20-17-11-4-5-12-18(17)29(26,27)24-20/h1-13,19H,(H,23,24).
What are the key properties of [3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2-chloro-2-phenylacetate?
[3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2-chloro-2-phenylacetate has a molecular weight of 426.88 g/mol, XLogP of 4.13, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2-chloro-2-phenylacetate is sourced from PubChem (CID 21213578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).