C21H15ClN2O4S — CID 21213578
[3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2-chloro-2-phenylacetate (PubChem CID 21213578) has the molecular formula C21H15ClN2O4S and a molecular weight of 426.88 g/mol. Its IUPAC name is [3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2-chloro-2-phenylacetate.
| Compound Name | [3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2-chloro-2-phenylacetate |
|---|---|
| PubChem CID | 21213578 |
| Molecular Formula | C21H15ClN2O4S |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | [3-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2-chloro-2-phenylacetate |
| SMILES | O=C(Oc1cccc(NC2=NS(=O)(=O)c3ccccc32)c1)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C21H15ClN2O4S/c22-19(14-7-2-1-3-8-14)21(25)28-16-10-6-9-15(13-16)23-20-17-11-4-5-12-18(17)29(26,27)24-20/h1-13,19H,(H,23,24) |
| InChIKey | KHNIAGKKSTYRCO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|