C20H12Cl2N2O4S — CID 75537571
[2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2,4-dichlorobenzoate (PubChem CID 75537571) has the molecular formula C20H12Cl2N2O4S and a molecular weight of 447.30 g/mol. Its IUPAC name is [2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 75537571 |
| Molecular Formula | C20H12Cl2N2O4S |
| Molecular Weight | 447.30 g/mol |
| Exact Mass | 445.99 |
| IUPAC Name | [2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]phenyl] 2,4-dichlorobenzoate |
| SMILES | O=C(Oc1ccccc1NC1=NS(=O)(=O)c2ccccc21)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H12Cl2N2O4S/c21-12-9-10-13(15(22)11-12)20(25)28-17-7-3-2-6-16(17)23-19-14-5-1-4-8-18(14)29(26,27)24-19/h1-11H,(H,23,24) |
| InChIKey | AEJACVDXCKEFBG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.30 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|