C24H21N3O6S — CID 21213642
[4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-5-methyl-2-propan-2-ylphenyl] 4-nitrobenzoate (PubChem CID 21213642) has the molecular formula C24H21N3O6S and a molecular weight of 479.51 g/mol. Its IUPAC name is [4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-5-methyl-2-propan-2-ylphenyl] 4-nitrobenzoate.
| Compound Name | [4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-5-methyl-2-propan-2-ylphenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 21213642 |
| Molecular Formula | C24H21N3O6S |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | [4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-5-methyl-2-propan-2-ylphenyl] 4-nitrobenzoate |
| SMILES | Cc1cc(OC(=O)c2ccc([N+](=O)[O-])cc2)c(C(C)C)cc1NC1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C24H21N3O6S/c1-14(2)19-13-20(25-23-18-6-4-5-7-22(18)34(31,32)26-23)15(3)12-21(19)33-24(28)16-8-10-17(11-9-16)27(29)30/h4-14H,1-3H3,(H,25,26) |
| InChIKey | FDACDNJUTKECKE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|