C14H11N3O4S — CID 71296505
N-(2-methyl-6-nitrophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine (PubChem CID 71296505) has the molecular formula C14H11N3O4S and a molecular weight of 317.33 g/mol. Its IUPAC name is N-(2-methyl-6-nitrophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine.
| Compound Name | N-(2-methyl-6-nitrophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 71296505 |
| Molecular Formula | C14H11N3O4S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-(2-methyl-6-nitrophenyl)-1,1-dioxo-1,2-benzothiazol-3-amine |
| SMILES | Cc1cccc([N+](=O)[O-])c1NC1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C14H11N3O4S/c1-9-5-4-7-11(17(18)19)13(9)15-14-10-6-2-3-8-12(10)22(20,21)16-14/h2-8H,1H3,(H,15,16) |
| InChIKey | SVKNOQMVUOZEHS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|