C14H11N3O3S — CID 733227
2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide (PubChem CID 733227) has the molecular formula C14H11N3O3S and a molecular weight of 301.33 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide |
|---|---|
| PubChem CID | 733227 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzamide |
| SMILES | NC(=O)c1ccccc1NC1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C14H11N3O3S/c15-13(18)9-5-1-3-7-11(9)16-14-10-6-2-4-8-12(10)21(19,20)17-14/h1-8H,(H2,15,18)(H,16,17) |
| InChIKey | RBBYVNVBAQRAQI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |