About 2-(chloroamino)benzamide
2-(chloroamino)benzamide (PubChem CID 54562633) has the molecular formula C7H7ClN2O
and a molecular weight of 170.60 g/mol. Its IUPAC name is 2-(chloroamino)benzamide.
Molecular Properties
| Compound Name | 2-(chloroamino)benzamide |
| PubChem CID | 54562633 |
| Molecular Formula | C7H7ClN2O |
| Molecular Weight | 170.60 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | 2-(chloroamino)benzamide |
| SMILES | NC(=O)c1ccccc1NCl |
| InChI | InChI=1S/C7H7ClN2O/c8-10-6-4-2-1-3-5(6)7(9)11/h1-4,10H,(H2,9,11) |
| InChIKey | ZRPUEAFJIQGCTP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.60 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloroamino)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloroamino)benzamide?
The IUPAC name of 2-(chloroamino)benzamide (CID 54562633) is 2-(chloroamino)benzamide.
What is the SMILES notation for 2-(chloroamino)benzamide?
The canonical SMILES for 2-(chloroamino)benzamide is NC(=O)c1ccccc1NCl.
What is the InChIKey of 2-(chloroamino)benzamide?
The InChIKey is ZRPUEAFJIQGCTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN2O/c8-10-6-4-2-1-3-5(6)7(9)11/h1-4,10H,(H2,9,11).
What are the key properties of 2-(chloroamino)benzamide?
2-(chloroamino)benzamide has a molecular weight of 170.60 g/mol, XLogP of 1.35, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloroamino)benzamide is sourced from PubChem (CID 54562633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).