C14H7F11N2O2 — CID 4582177
N-(2-carbamoylphenyl)-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide (PubChem CID 4582177) has the molecular formula C14H7F11N2O2 and a molecular weight of 444.20 g/mol. Its IUPAC name is N-(2-carbamoylphenyl)-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide.
| Compound Name | N-(2-carbamoylphenyl)-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 4582177 |
| Molecular Formula | C14H7F11N2O2 |
| Molecular Weight | 444.20 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | N-(2-carbamoylphenyl)-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide |
| SMILES | NC(=O)c1ccccc1NC(=O)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14H7F11N2O2/c15-9(8(29)27-6-4-2-1-3-5(6)7(26)28)10(16,17)12(20,21)14(24,25)13(22,23)11(9,18)19/h1-4H,(H2,26,28)(H,27,29) |
| InChIKey | LCUVJSFZAMNYPN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.20 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|