C15H13N3O5S — CID 3941145
N-(2-ethoxyphenyl)-6-nitro-1,1-dioxo-1,2-benzothiazol-3-amine (PubChem CID 3941145) has the molecular formula C15H13N3O5S and a molecular weight of 347.35 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-6-nitro-1,1-dioxo-1,2-benzothiazol-3-amine.
| Compound Name | N-(2-ethoxyphenyl)-6-nitro-1,1-dioxo-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 3941145 |
| Molecular Formula | C15H13N3O5S |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N-(2-ethoxyphenyl)-6-nitro-1,1-dioxo-1,2-benzothiazol-3-amine |
| SMILES | CCOc1ccccc1NC1=NS(=O)(=O)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C15H13N3O5S/c1-2-23-13-6-4-3-5-12(13)16-15-11-8-7-10(18(19)20)9-14(11)24(21,22)17-15/h3-9H,2H2,1H3,(H,16,17) |
| InChIKey | RXDWOGVGOSYAMT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|