C23H21N5O5S — CID 3504041
N-[3-(2-ethoxyanilino)quinoxalin-2-yl]-2-methyl-5-nitrobenzenesulfonamide (PubChem CID 3504041) has the molecular formula C23H21N5O5S and a molecular weight of 479.52 g/mol. Its IUPAC name is N-[3-(2-ethoxyanilino)quinoxalin-2-yl]-2-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-[3-(2-ethoxyanilino)quinoxalin-2-yl]-2-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3504041 |
| Molecular Formula | C23H21N5O5S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | N-[3-(2-ethoxyanilino)quinoxalin-2-yl]-2-methyl-5-nitrobenzenesulfonamide |
| SMILES | CCOc1ccccc1Nc1nc2ccccc2nc1NS(=O)(=O)c1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C23H21N5O5S/c1-3-33-20-11-7-6-10-19(20)26-22-23(25-18-9-5-4-8-17(18)24-22)27-34(31,32)21-14-16(28(29)30)13-12-15(21)2/h4-14H,3H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | HIHBLLSPZGSZSV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|