C22H18ClN5O4S — CID 3389592
N-[3-(4-chloro-3-nitroanilino)quinoxalin-2-yl]-2,5-dimethylbenzenesulfonamide (PubChem CID 3389592) has the molecular formula C22H18ClN5O4S and a molecular weight of 483.94 g/mol. Its IUPAC name is N-[3-(4-chloro-3-nitroanilino)quinoxalin-2-yl]-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[3-(4-chloro-3-nitroanilino)quinoxalin-2-yl]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3389592 |
| Molecular Formula | C22H18ClN5O4S |
| Molecular Weight | 483.94 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | N-[3-(4-chloro-3-nitroanilino)quinoxalin-2-yl]-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2nc3ccccc3nc2Nc2ccc(Cl)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C22H18ClN5O4S/c1-13-7-8-14(2)20(11-13)33(31,32)27-22-21(25-17-5-3-4-6-18(17)26-22)24-15-9-10-16(23)19(12-15)28(29)30/h3-12H,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | OQKVYZLLZDOIGS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.94 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|