C21H26N4O2S — CID 1398272
2,5-dimethyl-N-[3-(3-methylbutylamino)quinoxalin-2-yl]benzenesulfonamide (PubChem CID 1398272) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is 2,5-dimethyl-N-[3-(3-methylbutylamino)quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-[3-(3-methylbutylamino)quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 1398272 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2,5-dimethyl-N-[3-(3-methylbutylamino)quinoxalin-2-yl]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2nc3ccccc3nc2NCCC(C)C)c1 |
| InChI | InChI=1S/C21H26N4O2S/c1-14(2)11-12-22-20-21(24-18-8-6-5-7-17(18)23-20)25-28(26,27)19-13-15(3)9-10-16(19)4/h5-10,13-14H,11-12H2,1-4H3,(H,22,23)(H,24,25) |
| InChIKey | XQALNUKULLGGPI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |