C17H10N2O5S — CID 71296428
3-naphthalen-1-yloxy-6-nitro-1,2-benzothiazole 1,1-dioxide (PubChem CID 71296428) has the molecular formula C17H10N2O5S and a molecular weight of 354.34 g/mol. Its IUPAC name is 3-naphthalen-1-yloxy-6-nitro-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 3-naphthalen-1-yloxy-6-nitro-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 71296428 |
| Molecular Formula | C17H10N2O5S |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 3-naphthalen-1-yloxy-6-nitro-1,2-benzothiazole 1,1-dioxide |
| SMILES | O=[N+]([O-])c1ccc2c(c1)S(=O)(=O)N=C2Oc1cccc2ccccc12 |
| InChI | InChI=1S/C17H10N2O5S/c20-19(21)12-8-9-14-16(10-12)25(22,23)18-17(14)24-15-7-3-5-11-4-1-2-6-13(11)15/h1-10H |
| InChIKey | YNBMNIXCIQZMRT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 98.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|