C14H10N2O6S — CID 2841116
3-(2-methoxyphenoxy)-6-nitro-1,2-benzothiazole 1,1-dioxide (PubChem CID 2841116) has the molecular formula C14H10N2O6S and a molecular weight of 334.31 g/mol. Its IUPAC name is 3-(2-methoxyphenoxy)-6-nitro-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 3-(2-methoxyphenoxy)-6-nitro-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 2841116 |
| Molecular Formula | C14H10N2O6S |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 3-(2-methoxyphenoxy)-6-nitro-1,2-benzothiazole 1,1-dioxide |
| SMILES | COc1ccccc1OC1=NS(=O)(=O)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C14H10N2O6S/c1-21-11-4-2-3-5-12(11)22-14-10-7-6-9(16(17)18)8-13(10)23(19,20)15-14/h2-8H,1H3 |
| InChIKey | NOYAEGUGWRTKSL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|