C23H21N3O6S — CID 71296474
6-nitro-1,1-dioxo-N,N-bis(2-phenoxyethyl)-1,2-benzothiazol-3-amine (PubChem CID 71296474) has the molecular formula C23H21N3O6S and a molecular weight of 467.50 g/mol. Its IUPAC name is 6-nitro-1,1-dioxo-N,N-bis(2-phenoxyethyl)-1,2-benzothiazol-3-amine.
| Compound Name | 6-nitro-1,1-dioxo-N,N-bis(2-phenoxyethyl)-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 71296474 |
| Molecular Formula | C23H21N3O6S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 6-nitro-1,1-dioxo-N,N-bis(2-phenoxyethyl)-1,2-benzothiazol-3-amine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)S(=O)(=O)N=C2N(CCOc1ccccc1)CCOc1ccccc1 |
| InChI | InChI=1S/C23H21N3O6S/c27-26(28)18-11-12-21-22(17-18)33(29,30)24-23(21)25(13-15-31-19-7-3-1-4-8-19)14-16-32-20-9-5-2-6-10-20/h1-12,17H,13-16H2 |
| InChIKey | GTKJJGCTXMWDSS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|