C17H13N5O4S — CID 21229809
3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(E)-(4-nitrophenyl)methylideneamino]amino]propanenitrile (PubChem CID 21229809) has the molecular formula C17H13N5O4S and a molecular weight of 383.39 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(E)-(4-nitrophenyl)methylideneamino]amino]propanenitrile.
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(E)-(4-nitrophenyl)methylideneamino]amino]propanenitrile |
|---|---|
| PubChem CID | 21229809 |
| Molecular Formula | C17H13N5O4S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(E)-(4-nitrophenyl)methylideneamino]amino]propanenitrile |
| SMILES | N#CCCN(/N=C/c1ccc([N+](=O)[O-])cc1)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C17H13N5O4S/c18-10-3-11-21(19-12-13-6-8-14(9-7-13)22(23)24)17-15-4-1-2-5-16(15)27(25,26)20-17/h1-2,4-9,12H,3,11H2/b19-12+ |
| InChIKey | ZNBXCEXHZGXLEG-XDHOZWIPSA-N |
| XLogP | 2.29 |
| TPSA | 129.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|