C25H25N5O6S — CID 6120214
N-tert-butyl-3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]amino]propanamide (PubChem CID 6120214) has the molecular formula C25H25N5O6S and a molecular weight of 523.57 g/mol. Its IUPAC name is N-tert-butyl-3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]amino]propanamide.
| Compound Name | N-tert-butyl-3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]amino]propanamide |
|---|---|
| PubChem CID | 6120214 |
| Molecular Formula | C25H25N5O6S |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | N-tert-butyl-3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(Z)-[5-(4-nitrophenyl)furan-2-yl]methylideneamino]amino]propanamide |
| SMILES | CC(C)(C)NC(=O)CCN(/N=C\c1ccc(-c2ccc([N+](=O)[O-])cc2)o1)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C25H25N5O6S/c1-25(2,3)27-23(31)14-15-29(24-20-6-4-5-7-22(20)37(34,35)28-24)26-16-19-12-13-21(36-19)17-8-10-18(11-9-17)30(32)33/h4-13,16H,14-15H2,1-3H3,(H,27,31)/b26-16- |
| InChIKey | BCGJZUUHMDJTIM-QQXSKIMKSA-N |
| XLogP | 3.94 |
| TPSA | 147.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|