C22H24N4O5S — CID 3291229
3-[(1,3-benzodioxol-5-ylmethylideneamino)-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-tert-butylpropanamide (PubChem CID 3291229) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is 3-[(1,3-benzodioxol-5-ylmethylideneamino)-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-tert-butylpropanamide.
| Compound Name | 3-[(1,3-benzodioxol-5-ylmethylideneamino)-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-tert-butylpropanamide |
|---|---|
| PubChem CID | 3291229 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 3-[(1,3-benzodioxol-5-ylmethylideneamino)-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-tert-butylpropanamide |
| SMILES | CC(C)(C)NC(=O)CCN(N=Cc1ccc2c(c1)OCO2)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C22H24N4O5S/c1-22(2,3)24-20(27)10-11-26(21-16-6-4-5-7-19(16)32(28,29)25-21)23-13-15-8-9-17-18(12-15)31-14-30-17/h4-9,12-13H,10-11,14H2,1-3H3,(H,24,27) |
| InChIKey | HVNWLOYZEYSZBB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|