C23H25BrN4O4S — CID 3846299
3-[[(5-bromo-2-hydroxyphenyl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-cyclohexylpropanamide (PubChem CID 3846299) has the molecular formula C23H25BrN4O4S and a molecular weight of 533.45 g/mol. Its IUPAC name is 3-[[(5-bromo-2-hydroxyphenyl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-cyclohexylpropanamide.
| Compound Name | 3-[[(5-bromo-2-hydroxyphenyl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 3846299 |
| Molecular Formula | C23H25BrN4O4S |
| Molecular Weight | 533.45 g/mol |
| Exact Mass | 532.08 |
| IUPAC Name | 3-[[(5-bromo-2-hydroxyphenyl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-cyclohexylpropanamide |
| SMILES | O=C(CCN(N=Cc1cc(Br)ccc1O)C1=NS(=O)(=O)c2ccccc21)NC1CCCCC1 |
| InChI | InChI=1S/C23H25BrN4O4S/c24-17-10-11-20(29)16(14-17)15-25-28(13-12-22(30)26-18-6-2-1-3-7-18)23-19-8-4-5-9-21(19)33(31,32)27-23/h4-5,8-11,14-15,18,29H,1-3,6-7,12-13H2,(H,26,30) |
| InChIKey | PDWLDPXUVDBGNH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|