C24H21N3O5S — CID 3686778
2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(2-methoxyphenyl)methylideneamino]amino]ethyl benzoate (PubChem CID 3686778) has the molecular formula C24H21N3O5S and a molecular weight of 463.52 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(2-methoxyphenyl)methylideneamino]amino]ethyl benzoate.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(2-methoxyphenyl)methylideneamino]amino]ethyl benzoate |
|---|---|
| PubChem CID | 3686778 |
| Molecular Formula | C24H21N3O5S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(2-methoxyphenyl)methylideneamino]amino]ethyl benzoate |
| SMILES | COc1ccccc1C=NN(CCOC(=O)c1ccccc1)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C24H21N3O5S/c1-31-21-13-7-5-11-19(21)17-25-27(15-16-32-24(28)18-9-3-2-4-10-18)23-20-12-6-8-14-22(20)33(29,30)26-23/h2-14,17H,15-16H2,1H3 |
| InChIKey | ZFELGWFCPAYECG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|