C23H18ClN3O5S — CID 94849330
[2-[(Z)-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylhydrazinylidene]methyl]-6-methoxyphenyl] 4-chlorobenzoate (PubChem CID 94849330) has the molecular formula C23H18ClN3O5S and a molecular weight of 483.93 g/mol. Its IUPAC name is [2-[(Z)-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylhydrazinylidene]methyl]-6-methoxyphenyl] 4-chlorobenzoate.
| Compound Name | [2-[(Z)-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylhydrazinylidene]methyl]-6-methoxyphenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 94849330 |
| Molecular Formula | C23H18ClN3O5S |
| Molecular Weight | 483.93 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | [2-[(Z)-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylhydrazinylidene]methyl]-6-methoxyphenyl] 4-chlorobenzoate |
| SMILES | COc1cccc(/C=N\N(C)C2=NS(=O)(=O)c3ccccc32)c1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18ClN3O5S/c1-27(22-18-7-3-4-9-20(18)33(29,30)26-22)25-14-16-6-5-8-19(31-2)21(16)32-23(28)15-10-12-17(24)13-11-15/h3-14H,1-2H3/b25-14- |
| InChIKey | ZTIKOWMUADWHSL-QFEZKATASA-N |
| XLogP | 3.98 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.93 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|