C24H20ClN3O5S — CID 94849333
2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(Z)-(2-methoxyphenyl)methylideneamino]amino]ethyl 4-chlorobenzoate (PubChem CID 94849333) has the molecular formula C24H20ClN3O5S and a molecular weight of 497.96 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(Z)-(2-methoxyphenyl)methylideneamino]amino]ethyl 4-chlorobenzoate.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(Z)-(2-methoxyphenyl)methylideneamino]amino]ethyl 4-chlorobenzoate |
|---|---|
| PubChem CID | 94849333 |
| Molecular Formula | C24H20ClN3O5S |
| Molecular Weight | 497.96 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(Z)-(2-methoxyphenyl)methylideneamino]amino]ethyl 4-chlorobenzoate |
| SMILES | COc1ccccc1/C=N\N(CCOC(=O)c1ccc(Cl)cc1)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C24H20ClN3O5S/c1-32-21-8-4-2-6-18(21)16-26-28(14-15-33-24(29)17-10-12-19(25)13-11-17)23-20-7-3-5-9-22(20)34(30,31)27-23/h2-13,16H,14-15H2,1H3/b26-16- |
| InChIKey | HLVSZUUSUYJIEP-QQXSKIMKSA-N |
| XLogP | 3.99 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.96 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|