C23H18FN3O5S — CID 1253620
[2-[[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylhydrazinylidene]methyl]-6-methoxyphenyl] 2-fluorobenzoate (PubChem CID 1253620) has the molecular formula C23H18FN3O5S and a molecular weight of 467.48 g/mol. Its IUPAC name is [2-[[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylhydrazinylidene]methyl]-6-methoxyphenyl] 2-fluorobenzoate.
| Compound Name | [2-[[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylhydrazinylidene]methyl]-6-methoxyphenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 1253620 |
| Molecular Formula | C23H18FN3O5S |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | [2-[[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylhydrazinylidene]methyl]-6-methoxyphenyl] 2-fluorobenzoate |
| SMILES | COc1cccc(C=NN(C)C2=NS(=O)(=O)c3ccccc32)c1OC(=O)c1ccccc1F |
| InChI | InChI=1S/C23H18FN3O5S/c1-27(22-17-10-4-6-13-20(17)33(29,30)26-22)25-14-15-8-7-12-19(31-2)21(15)32-23(28)16-9-3-5-11-18(16)24/h3-14H,1-2H3 |
| InChIKey | GRYRLTJOQKSOKN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|