C18H16F3N3O5S — CID 177250862
2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(E)-[2-methoxy-5-(trifluoromethoxy)phenyl]methylideneamino]amino]ethanol (PubChem CID 177250862) has the molecular formula C18H16F3N3O5S and a molecular weight of 443.40 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(E)-[2-methoxy-5-(trifluoromethoxy)phenyl]methylideneamino]amino]ethanol.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(E)-[2-methoxy-5-(trifluoromethoxy)phenyl]methylideneamino]amino]ethanol |
|---|---|
| PubChem CID | 177250862 |
| Molecular Formula | C18H16F3N3O5S |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(E)-[2-methoxy-5-(trifluoromethoxy)phenyl]methylideneamino]amino]ethanol |
| SMILES | COc1ccc(OC(F)(F)F)cc1/C=N/N(CCO)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C18H16F3N3O5S/c1-28-15-7-6-13(29-18(19,20)21)10-12(15)11-22-24(8-9-25)17-14-4-2-3-5-16(14)30(26,27)23-17/h2-7,10-11,25H,8-9H2,1H3/b22-11+ |
| InChIKey | FECINOFBIJYWJY-SSDVNMTOSA-N |
| XLogP | 2.37 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|