C14H12IN3O4S — CID 21229793
2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(E)-(5-iodofuran-2-yl)methylideneamino]amino]ethanol (PubChem CID 21229793) has the molecular formula C14H12IN3O4S and a molecular weight of 445.24 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(E)-(5-iodofuran-2-yl)methylideneamino]amino]ethanol.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(E)-(5-iodofuran-2-yl)methylideneamino]amino]ethanol |
|---|---|
| PubChem CID | 21229793 |
| Molecular Formula | C14H12IN3O4S |
| Molecular Weight | 445.24 g/mol |
| Exact Mass | 444.96 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(E)-(5-iodofuran-2-yl)methylideneamino]amino]ethanol |
| SMILES | O=S1(=O)N=C(N(CCO)/N=C/c2ccc(I)o2)c2ccccc21 |
| InChI | InChI=1S/C14H12IN3O4S/c15-13-6-5-10(22-13)9-16-18(7-8-19)14-11-3-1-2-4-12(11)23(20,21)17-14/h1-6,9,19H,7-8H2/b16-9+ |
| InChIKey | CFKAMMGYNAXIKI-CXUHLZMHSA-N |
| XLogP | 1.66 |
| TPSA | 95.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|