C21H22N4O3S — CID 6120212
3-[[(Z)-(4-butoxyphenyl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]propanenitrile (PubChem CID 6120212) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is 3-[[(Z)-(4-butoxyphenyl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]propanenitrile.
| Compound Name | 3-[[(Z)-(4-butoxyphenyl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]propanenitrile |
|---|---|
| PubChem CID | 6120212 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 3-[[(Z)-(4-butoxyphenyl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]propanenitrile |
| SMILES | CCCCOc1ccc(/C=N\N(CCC#N)C2=NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C21H22N4O3S/c1-2-3-15-28-18-11-9-17(10-12-18)16-23-25(14-6-13-22)21-19-7-4-5-8-20(19)29(26,27)24-21/h4-5,7-12,16H,2-3,6,14-15H2,1H3/b23-16- |
| InChIKey | QBBCLQFBBDEKGD-KQWNVCNZSA-N |
| XLogP | 3.56 |
| TPSA | 95.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|