C22H26N4O4S — CID 4619533
3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(4-methoxyphenyl)methylideneamino]amino]-N,N-diethylpropanamide (PubChem CID 4619533) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(4-methoxyphenyl)methylideneamino]amino]-N,N-diethylpropanamide.
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(4-methoxyphenyl)methylideneamino]amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 4619533 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(4-methoxyphenyl)methylideneamino]amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCN(N=Cc1ccc(OC)cc1)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C22H26N4O4S/c1-4-25(5-2)21(27)14-15-26(23-16-17-10-12-18(30-3)13-11-17)22-19-8-6-7-9-20(19)31(28,29)24-22/h6-13,16H,4-5,14-15H2,1-3H3 |
| InChIKey | CWAMEOUKENTTDE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 91.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|