C24H20N4O7S — CID 94849331
2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(Z)-(4-methoxyphenyl)methylideneamino]amino]ethyl 4-nitrobenzoate (PubChem CID 94849331) has the molecular formula C24H20N4O7S and a molecular weight of 508.51 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(Z)-(4-methoxyphenyl)methylideneamino]amino]ethyl 4-nitrobenzoate.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(Z)-(4-methoxyphenyl)methylideneamino]amino]ethyl 4-nitrobenzoate |
|---|---|
| PubChem CID | 94849331 |
| Molecular Formula | C24H20N4O7S |
| Molecular Weight | 508.51 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-[(Z)-(4-methoxyphenyl)methylideneamino]amino]ethyl 4-nitrobenzoate |
| SMILES | COc1ccc(/C=N\N(CCOC(=O)c2ccc([N+](=O)[O-])cc2)C2=NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H20N4O7S/c1-34-20-12-6-17(7-13-20)16-25-27(23-21-4-2-3-5-22(21)36(32,33)26-23)14-15-35-24(29)18-8-10-19(11-9-18)28(30)31/h2-13,16H,14-15H2,1H3/b25-16- |
| InChIKey | PYKPXKZIAGNMTR-XYGWBWBKSA-N |
| XLogP | 3.25 |
| TPSA | 140.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|