C23H25ClN4O3S — CID 3291418
3-[[(2-chlorophenyl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-cyclohexylpropanamide (PubChem CID 3291418) has the molecular formula C23H25ClN4O3S and a molecular weight of 473.00 g/mol. Its IUPAC name is 3-[[(2-chlorophenyl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-cyclohexylpropanamide.
| Compound Name | 3-[[(2-chlorophenyl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 3291418 |
| Molecular Formula | C23H25ClN4O3S |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 3-[[(2-chlorophenyl)methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-cyclohexylpropanamide |
| SMILES | O=C(CCN(N=Cc1ccccc1Cl)C1=NS(=O)(=O)c2ccccc21)NC1CCCCC1 |
| InChI | InChI=1S/C23H25ClN4O3S/c24-20-12-6-4-8-17(20)16-25-28(15-14-22(29)26-18-9-2-1-3-10-18)23-19-11-5-7-13-21(19)32(30,31)27-23/h4-8,11-13,16,18H,1-3,9-10,14-15H2,(H,26,29) |
| InChIKey | WDIWLCVKDDOCRR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|