C22H24N4O6S — CID 136693073
5-[(Z)-[[3-(tert-butylamino)-3-oxopropyl]-(1,1-dioxo-1,2-benzothiazol-3-yl)hydrazinylidene]methyl]-2-hydroxybenzoic acid (PubChem CID 136693073) has the molecular formula C22H24N4O6S and a molecular weight of 472.52 g/mol. Its IUPAC name is 5-[(Z)-[[3-(tert-butylamino)-3-oxopropyl]-(1,1-dioxo-1,2-benzothiazol-3-yl)hydrazinylidene]methyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[(Z)-[[3-(tert-butylamino)-3-oxopropyl]-(1,1-dioxo-1,2-benzothiazol-3-yl)hydrazinylidene]methyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 136693073 |
| Molecular Formula | C22H24N4O6S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 5-[(Z)-[[3-(tert-butylamino)-3-oxopropyl]-(1,1-dioxo-1,2-benzothiazol-3-yl)hydrazinylidene]methyl]-2-hydroxybenzoic acid |
| SMILES | CC(C)(C)NC(=O)CCN(/N=C\c1ccc(O)c(C(=O)O)c1)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C22H24N4O6S/c1-22(2,3)24-19(28)10-11-26(20-15-6-4-5-7-18(15)33(31,32)25-20)23-13-14-8-9-17(27)16(12-14)21(29)30/h4-9,12-13,27H,10-11H2,1-3H3,(H,24,28)(H,29,30)/b23-13- |
| InChIKey | WBAZZTSVAWPYMK-QRVIBDJDSA-N |
| XLogP | 2.18 |
| TPSA | 148.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|