C27H35N5O3S — CID 21229802
N-cyclohexyl-3-[[(E)-[4-(diethylamino)phenyl]methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]propanamide (PubChem CID 21229802) has the molecular formula C27H35N5O3S and a molecular weight of 509.68 g/mol. Its IUPAC name is N-cyclohexyl-3-[[(E)-[4-(diethylamino)phenyl]methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]propanamide.
| Compound Name | N-cyclohexyl-3-[[(E)-[4-(diethylamino)phenyl]methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]propanamide |
|---|---|
| PubChem CID | 21229802 |
| Molecular Formula | C27H35N5O3S |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | N-cyclohexyl-3-[[(E)-[4-(diethylamino)phenyl]methylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]propanamide |
| SMILES | CCN(CC)c1ccc(/C=N/N(CCC(=O)NC2CCCCC2)C2=NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H35N5O3S/c1-3-31(4-2)23-16-14-21(15-17-23)20-28-32(19-18-26(33)29-22-10-6-5-7-11-22)27-24-12-8-9-13-25(24)36(34,35)30-27/h8-9,12-17,20,22H,3-7,10-11,18-19H2,1-2H3,(H,29,33)/b28-20+ |
| InChIKey | GYEWIHFDZSFPGK-VFCFBJKWSA-N |
| XLogP | 4.16 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|