C19H28N4O2 — CID 51064202
N-cyclohexyl-N'-[(E)-[4-(dimethylamino)phenyl]methylideneamino]butanediamide (PubChem CID 51064202) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-cyclohexyl-N'-[(E)-[4-(dimethylamino)phenyl]methylideneamino]butanediamide.
| Compound Name | N-cyclohexyl-N'-[(E)-[4-(dimethylamino)phenyl]methylideneamino]butanediamide |
|---|---|
| PubChem CID | 51064202 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | N-cyclohexyl-N'-[(E)-[4-(dimethylamino)phenyl]methylideneamino]butanediamide |
| SMILES | CN(C)c1ccc(/C=N/NC(=O)CCC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H28N4O2/c1-23(2)17-10-8-15(9-11-17)14-20-22-19(25)13-12-18(24)21-16-6-4-3-5-7-16/h8-11,14,16H,3-7,12-13H2,1-2H3,(H,21,24)(H,22,25)/b20-14+ |
| InChIKey | LWAWAGOLKDZKNX-XSFVSMFZSA-N |
| XLogP | 2.43 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|